About cis-methyl (1R,2S)-3-oxo-2-(2-oxo-1,3-oxazolidine-3-carbonyl)cyclobutane-1-carboxylate
cis-methyl (1R,2S)-3-oxo-2-(2-oxo-1,3-oxazolidine-3-carbonyl)cyclobutane-1-carboxylate (PubChem CID 134922721) has the molecular formula C10H11NO6
and a molecular weight of 241.20 g/mol. Its IUPAC name is cis-methyl (1R,2S)-3-oxo-2-(2-oxo-1,3-oxazolidine-3-carbonyl)cyclobutane-1-carboxylate.
Molecular Properties
| Compound Name | cis-methyl (1R,2S)-3-oxo-2-(2-oxo-1,3-oxazolidine-3-carbonyl)cyclobutane-1-carboxylate |
| PubChem CID | 134922721 |
| Molecular Formula | C10H11NO6 |
| Molecular Weight | 241.20 g/mol |
| Exact Mass | 241.06 |
| IUPAC Name | cis-methyl (1R,2S)-3-oxo-2-(2-oxo-1,3-oxazolidine-3-carbonyl)cyclobutane-1-carboxylate |
| SMILES | COC(=O)[C@@H]1CC(=O)[C@H]1C(=O)N1CCOC1=O |
| InChI | InChI=1S/C10H11NO6/c1-16-9(14)5-4-6(12)7(5)8(13)11-2-3-17-10(11)15/h5,7H,2-4H2,1H3/t5-,7+/m1/s1 |
| InChIKey | WWSIRPBMVOKHNG-VDTYLAMSSA-N |
| XLogP | -0.66 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.20 |
| LogP ≤ 5 | -0.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze cis-methyl (1R,2S)-3-oxo-2-(2-oxo-1,3-oxazolidine-3-carbonyl)cyclobutane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cis-methyl (1R,2S)-3-oxo-2-(2-oxo-1,3-oxazolidine-3-carbonyl)cyclobutane-1-carboxylate?
The IUPAC name of cis-methyl (1R,2S)-3-oxo-2-(2-oxo-1,3-oxazolidine-3-carbonyl)cyclobutane-1-carboxylate (CID 134922721) is cis-methyl (1R,2S)-3-oxo-2-(2-oxo-1,3-oxazolidine-3-carbonyl)cyclobutane-1-carboxylate.
What is the SMILES notation for cis-methyl (1R,2S)-3-oxo-2-(2-oxo-1,3-oxazolidine-3-carbonyl)cyclobutane-1-carboxylate?
The canonical SMILES for cis-methyl (1R,2S)-3-oxo-2-(2-oxo-1,3-oxazolidine-3-carbonyl)cyclobutane-1-carboxylate is COC(=O)[C@@H]1CC(=O)[C@H]1C(=O)N1CCOC1=O.
What is the InChIKey of cis-methyl (1R,2S)-3-oxo-2-(2-oxo-1,3-oxazolidine-3-carbonyl)cyclobutane-1-carboxylate?
The InChIKey is WWSIRPBMVOKHNG-VDTYLAMSSA-N. The full InChI is InChI=1S/C10H11NO6/c1-16-9(14)5-4-6(12)7(5)8(13)11-2-3-17-10(11)15/h5,7H,2-4H2,1H3/t5-,7+/m1/s1.
What are the key properties of cis-methyl (1R,2S)-3-oxo-2-(2-oxo-1,3-oxazolidine-3-carbonyl)cyclobutane-1-carboxylate?
cis-methyl (1R,2S)-3-oxo-2-(2-oxo-1,3-oxazolidine-3-carbonyl)cyclobutane-1-carboxylate has a molecular weight of 241.20 g/mol, XLogP of -0.66, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for cis-methyl (1R,2S)-3-oxo-2-(2-oxo-1,3-oxazolidine-3-carbonyl)cyclobutane-1-carboxylate is sourced from PubChem (CID 134922721), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).