C38H76O6Si3 — CID 134922783
2-trimethylsilylethyl (3S,6R,7S,8S)-3,7-bis[[tert-butyl(dimethyl)silyl]oxy]-4,4,6,8-tetramethyl-11-[(1R,2R)-1-methyl-2-(2-oxoethyl)cyclopropyl]-5-oxoundecanoate (PubChem CID 134922783) has the molecular formula C38H76O6Si3 and a molecular weight of 713.28 g/mol. Its IUPAC name is 2-trimethylsilylethyl (3S,6R,7S,8S)-3,7-bis[[tert-butyl(dimethyl)silyl]oxy]-4,4,6,8-tetramethyl-11-[(1R,2R)-1-methyl-2-(2-oxoethyl)cyclopropyl]-5-oxoundecanoate.
| Compound Name | 2-trimethylsilylethyl (3S,6R,7S,8S)-3,7-bis[[tert-butyl(dimethyl)silyl]oxy]-4,4,6,8-tetramethyl-11-[(1R,2R)-1-methyl-2-(2-oxoethyl)cyclopropyl]-5-oxoundecanoate |
|---|---|
| PubChem CID | 134922783 |
| Molecular Formula | C38H76O6Si3 |
| Molecular Weight | 713.28 g/mol |
| Exact Mass | 712.49 |
| IUPAC Name | 2-trimethylsilylethyl (3S,6R,7S,8S)-3,7-bis[[tert-butyl(dimethyl)silyl]oxy]-4,4,6,8-tetramethyl-11-[(1R,2R)-1-methyl-2-(2-oxoethyl)cyclopropyl]-5-oxoundecanoate |
| SMILES | C[C@@H](CCC[C@]1(C)C[C@@H]1CC=O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)C(=O)C(C)(C)[C@H](CC(=O)OCC[Si](C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C38H76O6Si3/c1-28(20-19-22-38(11)27-30(38)21-23-39)33(44-47(17,18)36(6,7)8)29(2)34(41)37(9,10)31(43-46(15,16)35(3,4)5)26-32(40)42-24-25-45(12,13)14/h23,28-31,33H,19-22,24-27H2,1-18H3/t28-,29+,30-,31-,33-,38+/m0/s1 |
| InChIKey | XIIXUROTFJWINH-OYCQPXGYSA-N |
| XLogP | 10.69 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 713.28 |
| LogP ≤ 5 | 10.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|