C22H38O3Si — CID 134922793
(3R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-3-methyl-8-phenylmethoxyoctanal (PubChem CID 134922793) has the molecular formula C22H38O3Si and a molecular weight of 378.63 g/mol. Its IUPAC name is (3R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-3-methyl-8-phenylmethoxyoctanal.
| Compound Name | (3R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-3-methyl-8-phenylmethoxyoctanal |
|---|---|
| PubChem CID | 134922793 |
| Molecular Formula | C22H38O3Si |
| Molecular Weight | 378.63 g/mol |
| Exact Mass | 378.26 |
| IUPAC Name | (3R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-3-methyl-8-phenylmethoxyoctanal |
| SMILES | C[C@H](CC=O)[C@@H](CCCCOCc1ccccc1)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C22H38O3Si/c1-19(15-16-23)21(25-26(5,6)22(2,3)4)14-10-11-17-24-18-20-12-8-7-9-13-20/h7-9,12-13,16,19,21H,10-11,14-15,17-18H2,1-6H3/t19-,21-/m1/s1 |
| InChIKey | ZRDUGRDAYOYASJ-TZIWHRDSSA-N |
| XLogP | 5.99 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.63 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|