C16H16N4 — CID 13492281
N-phenyl-6,7,8,9-tetrahydro-5H-pyrimido[4,5-b]indol-4-amine (PubChem CID 13492281) has the molecular formula C16H16N4 and a molecular weight of 264.33 g/mol. Its IUPAC name is N-phenyl-6,7,8,9-tetrahydro-5H-pyrimido[4,5-b]indol-4-amine.
| Compound Name | N-phenyl-6,7,8,9-tetrahydro-5H-pyrimido[4,5-b]indol-4-amine |
|---|---|
| PubChem CID | 13492281 |
| Molecular Formula | C16H16N4 |
| Molecular Weight | 264.33 g/mol |
| Exact Mass | 264.14 |
| IUPAC Name | N-phenyl-6,7,8,9-tetrahydro-5H-pyrimido[4,5-b]indol-4-amine |
| SMILES | c1ccc(Nc2ncnc3[nH]c4c(c23)CCCC4)cc1 |
| InChI | InChI=1S/C16H16N4/c1-2-6-11(7-3-1)19-15-14-12-8-4-5-9-13(12)20-16(14)18-10-17-15/h1-3,6-7,10H,4-5,8-9H2,(H2,17,18,19,20) |
| InChIKey | ONNAZAHCACRHEO-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.33 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |