C15H14F3NO2S — CID 134922829
1,1,1-trifluoro-N-hexa-1,5-dien-3-yl-N-(2-phenylethynyl)methanesulfonamide (PubChem CID 134922829) has the molecular formula C15H14F3NO2S and a molecular weight of 329.34 g/mol. Its IUPAC name is 1,1,1-trifluoro-N-hexa-1,5-dien-3-yl-N-(2-phenylethynyl)methanesulfonamide.
| Compound Name | 1,1,1-trifluoro-N-hexa-1,5-dien-3-yl-N-(2-phenylethynyl)methanesulfonamide |
|---|---|
| PubChem CID | 134922829 |
| Molecular Formula | C15H14F3NO2S |
| Molecular Weight | 329.34 g/mol |
| Exact Mass | 329.07 |
| IUPAC Name | 1,1,1-trifluoro-N-hexa-1,5-dien-3-yl-N-(2-phenylethynyl)methanesulfonamide |
| SMILES | C=CCC(C=C)N(C#Cc1ccccc1)S(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C15H14F3NO2S/c1-3-8-14(4-2)19(22(20,21)15(16,17)18)12-11-13-9-6-5-7-10-13/h3-7,9-10,14H,1-2,8H2 |
| InChIKey | GZCVGFMPKLQRDT-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.34 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|