C11H14F7O3P — CID 134922874
1-di(propan-2-yloxy)phosphoryl-3,3,4,4,5,5,5-heptafluoropent-1-yne (PubChem CID 134922874) has the molecular formula C11H14F7O3P and a molecular weight of 358.19 g/mol. Its IUPAC name is 1-di(propan-2-yloxy)phosphoryl-3,3,4,4,5,5,5-heptafluoropent-1-yne.
| Compound Name | 1-di(propan-2-yloxy)phosphoryl-3,3,4,4,5,5,5-heptafluoropent-1-yne |
|---|---|
| PubChem CID | 134922874 |
| Molecular Formula | C11H14F7O3P |
| Molecular Weight | 358.19 g/mol |
| Exact Mass | 358.06 |
| IUPAC Name | 1-di(propan-2-yloxy)phosphoryl-3,3,4,4,5,5,5-heptafluoropent-1-yne |
| SMILES | CC(C)OP(=O)(C#CC(F)(F)C(F)(F)C(F)(F)F)OC(C)C |
| InChI | InChI=1S/C11H14F7O3P/c1-7(2)20-22(19,21-8(3)4)6-5-9(12,13)10(14,15)11(16,17)18/h7-8H,1-4H3 |
| InChIKey | HRRHKJYIMKXCGQ-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.19 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|