About 8-ethyl-1,4-dioxaspiro[4.5]dec-6-ene-8-carbaldehyde
8-ethyl-1,4-dioxaspiro[4.5]dec-6-ene-8-carbaldehyde (PubChem CID 134922899) has the molecular formula C11H16O3
and a molecular weight of 196.25 g/mol. Its IUPAC name is 8-ethyl-1,4-dioxaspiro[4.5]dec-6-ene-8-carbaldehyde.
Molecular Properties
| Compound Name | 8-ethyl-1,4-dioxaspiro[4.5]dec-6-ene-8-carbaldehyde |
| PubChem CID | 134922899 |
| Molecular Formula | C11H16O3 |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.11 |
| IUPAC Name | 8-ethyl-1,4-dioxaspiro[4.5]dec-6-ene-8-carbaldehyde |
| SMILES | CCC1(C=O)C=CC2(CC1)OCCO2 |
| InChI | InChI=1S/C11H16O3/c1-2-10(9-12)3-5-11(6-4-10)13-7-8-14-11/h3,5,9H,2,4,6-8H2,1H3 |
| InChIKey | RNDKORNZLPJJLH-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 8-ethyl-1,4-dioxaspiro[4.5]dec-6-ene-8-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-ethyl-1,4-dioxaspiro[4.5]dec-6-ene-8-carbaldehyde?
The IUPAC name of 8-ethyl-1,4-dioxaspiro[4.5]dec-6-ene-8-carbaldehyde (CID 134922899) is 8-ethyl-1,4-dioxaspiro[4.5]dec-6-ene-8-carbaldehyde.
What is the SMILES notation for 8-ethyl-1,4-dioxaspiro[4.5]dec-6-ene-8-carbaldehyde?
The canonical SMILES for 8-ethyl-1,4-dioxaspiro[4.5]dec-6-ene-8-carbaldehyde is CCC1(C=O)C=CC2(CC1)OCCO2.
What is the InChIKey of 8-ethyl-1,4-dioxaspiro[4.5]dec-6-ene-8-carbaldehyde?
The InChIKey is RNDKORNZLPJJLH-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16O3/c1-2-10(9-12)3-5-11(6-4-10)13-7-8-14-11/h3,5,9H,2,4,6-8H2,1H3.
What are the key properties of 8-ethyl-1,4-dioxaspiro[4.5]dec-6-ene-8-carbaldehyde?
8-ethyl-1,4-dioxaspiro[4.5]dec-6-ene-8-carbaldehyde has a molecular weight of 196.25 g/mol, XLogP of 1.67, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8-ethyl-1,4-dioxaspiro[4.5]dec-6-ene-8-carbaldehyde is sourced from PubChem (CID 134922899), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).