C11H15NO — CID 134922904
10-methyl-6,7,8,10a-tetrahydro-3H-pyrido[1,2-a]azepin-4-one (PubChem CID 134922904) has the molecular formula C11H15NO and a molecular weight of 177.25 g/mol. Its IUPAC name is 10-methyl-6,7,8,10a-tetrahydro-3H-pyrido[1,2-a]azepin-4-one.
| Compound Name | 10-methyl-6,7,8,10a-tetrahydro-3H-pyrido[1,2-a]azepin-4-one |
|---|---|
| PubChem CID | 134922904 |
| Molecular Formula | C11H15NO |
| Molecular Weight | 177.25 g/mol |
| Exact Mass | 177.12 |
| IUPAC Name | 10-methyl-6,7,8,10a-tetrahydro-3H-pyrido[1,2-a]azepin-4-one |
| SMILES | CC1=CCCCN2C(=O)CC=CC12 |
| InChI | InChI=1S/C11H15NO/c1-9-5-2-3-8-12-10(9)6-4-7-11(12)13/h4-6,10H,2-3,7-8H2,1H3 |
| InChIKey | WSPOOVJBMMDOQN-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.25 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|