C6H11NOS — CID 134923010
4,5-dimethyl-2,3-dihydro-1,4-thiazine 1-oxide (PubChem CID 134923010) has the molecular formula C6H11NOS and a molecular weight of 145.23 g/mol. Its IUPAC name is 4,5-dimethyl-2,3-dihydro-1,4-thiazine 1-oxide.
| Compound Name | 4,5-dimethyl-2,3-dihydro-1,4-thiazine 1-oxide |
|---|---|
| PubChem CID | 134923010 |
| Molecular Formula | C6H11NOS |
| Molecular Weight | 145.23 g/mol |
| Exact Mass | 145.06 |
| IUPAC Name | 4,5-dimethyl-2,3-dihydro-1,4-thiazine 1-oxide |
| SMILES | CC1=CS(=O)CCN1C |
| InChI | InChI=1S/C6H11NOS/c1-6-5-9(8)4-3-7(6)2/h5H,3-4H2,1-2H3 |
| InChIKey | KNKOCEFLUBBCCZ-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 145.23 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |