C11H16O3 — CID 13492306
ethyl 2,3,4-trimethyl-5-oxocyclopent-3-ene-1-carboxylate (PubChem CID 13492306) has the molecular formula C11H16O3 and a molecular weight of 196.25 g/mol. Its IUPAC name is ethyl 2,3,4-trimethyl-5-oxocyclopent-3-ene-1-carboxylate.
| Compound Name | ethyl 2,3,4-trimethyl-5-oxocyclopent-3-ene-1-carboxylate |
|---|---|
| PubChem CID | 13492306 |
| Molecular Formula | C11H16O3 |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.11 |
| IUPAC Name | ethyl 2,3,4-trimethyl-5-oxocyclopent-3-ene-1-carboxylate |
| SMILES | CCOC(=O)C1C(=O)C(C)=C(C)C1C |
| InChI | InChI=1S/C11H16O3/c1-5-14-11(13)9-7(3)6(2)8(4)10(9)12/h7,9H,5H2,1-4H3 |
| InChIKey | DCWISDNLMPDCJW-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|