C12H11F5N2O — CID 134923128
(2E)-1-(2,3,4,5,6-pentafluorophenyl)-2-pyrrolidin-1-yliminoethanol (PubChem CID 134923128) has the molecular formula C12H11F5N2O and a molecular weight of 294.22 g/mol. Its IUPAC name is (2E)-1-(2,3,4,5,6-pentafluorophenyl)-2-pyrrolidin-1-yliminoethanol.
| Compound Name | (2E)-1-(2,3,4,5,6-pentafluorophenyl)-2-pyrrolidin-1-yliminoethanol |
|---|---|
| PubChem CID | 134923128 |
| Molecular Formula | C12H11F5N2O |
| Molecular Weight | 294.22 g/mol |
| Exact Mass | 294.08 |
| IUPAC Name | (2E)-1-(2,3,4,5,6-pentafluorophenyl)-2-pyrrolidin-1-yliminoethanol |
| SMILES | OC(/C=N/N1CCCC1)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C12H11F5N2O/c13-8-7(9(14)11(16)12(17)10(8)15)6(20)5-18-19-3-1-2-4-19/h5-6,20H,1-4H2/b18-5+ |
| InChIKey | OWWGPHMNRVTSKD-BLLMUTORSA-N |
| XLogP | 2.50 |
| TPSA | 35.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.22 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|