About (2S,5S)-2-butylsulfanyl-5-(chloromethyl)-2-methyl-1,3-oxaselenolane
(2S,5S)-2-butylsulfanyl-5-(chloromethyl)-2-methyl-1,3-oxaselenolane (PubChem CID 134923209) has the molecular formula C9H17ClOSSe
and a molecular weight of 287.71 g/mol. Its IUPAC name is (2S,5S)-2-butylsulfanyl-5-(chloromethyl)-2-methyl-1,3-oxaselenolane.
Molecular Properties
| Compound Name | (2S,5S)-2-butylsulfanyl-5-(chloromethyl)-2-methyl-1,3-oxaselenolane |
| PubChem CID | 134923209 |
| Molecular Formula | C9H17ClOSSe |
| Molecular Weight | 287.71 g/mol |
| Exact Mass | 287.99 |
| IUPAC Name | (2S,5S)-2-butylsulfanyl-5-(chloromethyl)-2-methyl-1,3-oxaselenolane |
| SMILES | CCCCS[C@]1(C)O[C@@H](CCl)C[Se]1 |
| InChI | InChI=1S/C9H17ClOSSe/c1-3-4-5-12-9(2)11-8(6-10)7-13-9/h8H,3-7H2,1-2H3/t8-,9-/m0/s1 |
| InChIKey | CZHBKDIDBKLLPV-IUCAKERBSA-N |
| XLogP | 2.95 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.71 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze (2S,5S)-2-butylsulfanyl-5-(chloromethyl)-2-methyl-1,3-oxaselenolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S,5S)-2-butylsulfanyl-5-(chloromethyl)-2-methyl-1,3-oxaselenolane?
The IUPAC name of (2S,5S)-2-butylsulfanyl-5-(chloromethyl)-2-methyl-1,3-oxaselenolane (CID 134923209) is (2S,5S)-2-butylsulfanyl-5-(chloromethyl)-2-methyl-1,3-oxaselenolane.
What is the SMILES notation for (2S,5S)-2-butylsulfanyl-5-(chloromethyl)-2-methyl-1,3-oxaselenolane?
The canonical SMILES for (2S,5S)-2-butylsulfanyl-5-(chloromethyl)-2-methyl-1,3-oxaselenolane is CCCCS[C@]1(C)O[C@@H](CCl)C[Se]1.
What is the InChIKey of (2S,5S)-2-butylsulfanyl-5-(chloromethyl)-2-methyl-1,3-oxaselenolane?
The InChIKey is CZHBKDIDBKLLPV-IUCAKERBSA-N. The full InChI is InChI=1S/C9H17ClOSSe/c1-3-4-5-12-9(2)11-8(6-10)7-13-9/h8H,3-7H2,1-2H3/t8-,9-/m0/s1.
What are the key properties of (2S,5S)-2-butylsulfanyl-5-(chloromethyl)-2-methyl-1,3-oxaselenolane?
(2S,5S)-2-butylsulfanyl-5-(chloromethyl)-2-methyl-1,3-oxaselenolane has a molecular weight of 287.71 g/mol, XLogP of 2.95, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S,5S)-2-butylsulfanyl-5-(chloromethyl)-2-methyl-1,3-oxaselenolane is sourced from PubChem (CID 134923209), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).