About bis(6-diphenylphosphanyl-1H-pyridin-2-one);rhodium
bis(6-diphenylphosphanyl-1H-pyridin-2-one);rhodium (PubChem CID 134923247) has the molecular formula C34H28N2O2P2Rh
and a molecular weight of 661.46 g/mol. Its IUPAC name is bis(6-diphenylphosphanyl-1H-pyridin-2-one);rhodium.
Molecular Properties
| Compound Name | bis(6-diphenylphosphanyl-1H-pyridin-2-one);rhodium |
| PubChem CID | 134923247 |
| Molecular Formula | C34H28N2O2P2Rh |
| Molecular Weight | 661.46 g/mol |
| Exact Mass | 661.07 |
| IUPAC Name | bis(6-diphenylphosphanyl-1H-pyridin-2-one);rhodium |
| SMILES | O=c1cccc(P(c2ccccc2)c2ccccc2)[nH]1.O=c1cccc(P(c2ccccc2)c2ccccc2)[nH]1.[Rh] |
| InChI | InChI=1S/2C17H14NOP.Rh/c2*19-16-12-7-13-17(18-16)20(14-8-3-1-4-9-14)15-10-5-2-6-11-15;/h2*1-13H,(H,18,19); |
| InChIKey | SRLAJKZYBOHYBW-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 65.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 661.46 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze bis(6-diphenylphosphanyl-1H-pyridin-2-one);rhodium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(6-diphenylphosphanyl-1H-pyridin-2-one);rhodium?
The IUPAC name of bis(6-diphenylphosphanyl-1H-pyridin-2-one);rhodium (CID 134923247) is bis(6-diphenylphosphanyl-1H-pyridin-2-one);rhodium.
What is the SMILES notation for bis(6-diphenylphosphanyl-1H-pyridin-2-one);rhodium?
The canonical SMILES for bis(6-diphenylphosphanyl-1H-pyridin-2-one);rhodium is O=c1cccc(P(c2ccccc2)c2ccccc2)[nH]1.O=c1cccc(P(c2ccccc2)c2ccccc2)[nH]1.[Rh].
What is the InChIKey of bis(6-diphenylphosphanyl-1H-pyridin-2-one);rhodium?
The InChIKey is SRLAJKZYBOHYBW-UHFFFAOYSA-N. The full InChI is InChI=1S/2C17H14NOP.Rh/c2*19-16-12-7-13-17(18-16)20(14-8-3-1-4-9-14)15-10-5-2-6-11-15;/h2*1-13H,(H,18,19);.
What are the key properties of bis(6-diphenylphosphanyl-1H-pyridin-2-one);rhodium?
bis(6-diphenylphosphanyl-1H-pyridin-2-one);rhodium has a molecular weight of 661.46 g/mol, XLogP of 4.26, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for bis(6-diphenylphosphanyl-1H-pyridin-2-one);rhodium is sourced from PubChem (CID 134923247), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).