About 5-O-ethyl 1-O-methyl (Z,4E)-4-(1-benzylimidazolidin-2-ylidene)pent-2-enedioate
5-O-ethyl 1-O-methyl (Z,4E)-4-(1-benzylimidazolidin-2-ylidene)pent-2-enedioate (PubChem CID 134923543) has the molecular formula C18H22N2O4
and a molecular weight of 330.38 g/mol. Its IUPAC name is 5-O-ethyl 1-O-methyl (Z,4E)-4-(1-benzylimidazolidin-2-ylidene)pent-2-enedioate.
Molecular Properties
| Compound Name | 5-O-ethyl 1-O-methyl (Z,4E)-4-(1-benzylimidazolidin-2-ylidene)pent-2-enedioate |
| PubChem CID | 134923543 |
| Molecular Formula | C18H22N2O4 |
| Molecular Weight | 330.38 g/mol |
| Exact Mass | 330.16 |
| IUPAC Name | 5-O-ethyl 1-O-methyl (Z,4E)-4-(1-benzylimidazolidin-2-ylidene)pent-2-enedioate |
| SMILES | CCOC(=O)C(/C=C\C(=O)OC)=C1\NCCN1Cc1ccccc1 |
| InChI | InChI=1S/C18H22N2O4/c1-3-24-18(22)15(9-10-16(21)23-2)17-19-11-12-20(17)13-14-7-5-4-6-8-14/h4-10,19H,3,11-13H2,1-2H3/b10-9-,17-15+ |
| InChIKey | BRMBUSGUIOBLQE-BSGHAJBXSA-N |
| XLogP | 1.60 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.38 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 5-O-ethyl 1-O-methyl (Z,4E)-4-(1-benzylimidazolidin-2-ylidene)pent-2-enedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-O-ethyl 1-O-methyl (Z,4E)-4-(1-benzylimidazolidin-2-ylidene)pent-2-enedioate?
The IUPAC name of 5-O-ethyl 1-O-methyl (Z,4E)-4-(1-benzylimidazolidin-2-ylidene)pent-2-enedioate (CID 134923543) is 5-O-ethyl 1-O-methyl (Z,4E)-4-(1-benzylimidazolidin-2-ylidene)pent-2-enedioate.
What is the SMILES notation for 5-O-ethyl 1-O-methyl (Z,4E)-4-(1-benzylimidazolidin-2-ylidene)pent-2-enedioate?
The canonical SMILES for 5-O-ethyl 1-O-methyl (Z,4E)-4-(1-benzylimidazolidin-2-ylidene)pent-2-enedioate is CCOC(=O)C(/C=C\C(=O)OC)=C1\NCCN1Cc1ccccc1.
What is the InChIKey of 5-O-ethyl 1-O-methyl (Z,4E)-4-(1-benzylimidazolidin-2-ylidene)pent-2-enedioate?
The InChIKey is BRMBUSGUIOBLQE-BSGHAJBXSA-N. The full InChI is InChI=1S/C18H22N2O4/c1-3-24-18(22)15(9-10-16(21)23-2)17-19-11-12-20(17)13-14-7-5-4-6-8-14/h4-10,19H,3,11-13H2,1-2H3/b10-9-,17-15+.
What are the key properties of 5-O-ethyl 1-O-methyl (Z,4E)-4-(1-benzylimidazolidin-2-ylidene)pent-2-enedioate?
5-O-ethyl 1-O-methyl (Z,4E)-4-(1-benzylimidazolidin-2-ylidene)pent-2-enedioate has a molecular weight of 330.38 g/mol, XLogP of 1.60, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-O-ethyl 1-O-methyl (Z,4E)-4-(1-benzylimidazolidin-2-ylidene)pent-2-enedioate is sourced from PubChem (CID 134923543), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).