C13H24N2O — CID 134923648
(1Z,3E)-N,N-diethyl-1-morpholin-4-ylpenta-1,3-dien-1-amine (PubChem CID 134923648) has the molecular formula C13H24N2O and a molecular weight of 224.35 g/mol. Its IUPAC name is (1Z,3E)-N,N-diethyl-1-morpholin-4-ylpenta-1,3-dien-1-amine.
| Compound Name | (1Z,3E)-N,N-diethyl-1-morpholin-4-ylpenta-1,3-dien-1-amine |
|---|---|
| PubChem CID | 134923648 |
| Molecular Formula | C13H24N2O |
| Molecular Weight | 224.35 g/mol |
| Exact Mass | 224.19 |
| IUPAC Name | (1Z,3E)-N,N-diethyl-1-morpholin-4-ylpenta-1,3-dien-1-amine |
| SMILES | C/C=C/C=C(/N(CC)CC)N1CCOCC1 |
| InChI | InChI=1S/C13H24N2O/c1-4-7-8-13(14(5-2)6-3)15-9-11-16-12-10-15/h4,7-8H,5-6,9-12H2,1-3H3/b7-4+,13-8- |
| InChIKey | QBCYVYXNOUGIKT-XOHVCTMJSA-N |
| XLogP | 2.08 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.35 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|