C23H42N2 — CID 134923713
(1Z)-1-N'-butyl-1-N'-hept-2-ynyl-4-methyl-1-N,1-N-dipropylpenta-1,3-diene-1,1-diamine (PubChem CID 134923713) has the molecular formula C23H42N2 and a molecular weight of 346.60 g/mol. Its IUPAC name is (1Z)-1-N'-butyl-1-N'-hept-2-ynyl-4-methyl-1-N,1-N-dipropylpenta-1,3-diene-1,1-diamine.
| Compound Name | (1Z)-1-N'-butyl-1-N'-hept-2-ynyl-4-methyl-1-N,1-N-dipropylpenta-1,3-diene-1,1-diamine |
|---|---|
| PubChem CID | 134923713 |
| Molecular Formula | C23H42N2 |
| Molecular Weight | 346.60 g/mol |
| Exact Mass | 346.33 |
| IUPAC Name | (1Z)-1-N'-butyl-1-N'-hept-2-ynyl-4-methyl-1-N,1-N-dipropylpenta-1,3-diene-1,1-diamine |
| SMILES | CCCCC#CCN(CCCC)/C(=C\C=C(C)C)N(CCC)CCC |
| InChI | InChI=1S/C23H42N2/c1-7-11-13-14-15-21-25(20-12-8-2)23(17-16-22(5)6)24(18-9-3)19-10-4/h16-17H,7-13,18-21H2,1-6H3/b23-17- |
| InChIKey | QMBNUVXQLBSLSB-QJOMJCCJSA-N |
| XLogP | 6.21 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.60 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|