C25H37NO2Si — CID 134923906
[(3S,5S)-2-benzyl-5-phenyl-3-propan-2-yl-1,2-oxazolidin-5-yl]oxy-tert-butyl-dimethylsilane (PubChem CID 134923906) has the molecular formula C25H37NO2Si and a molecular weight of 411.66 g/mol. Its IUPAC name is [(3S,5S)-2-benzyl-5-phenyl-3-propan-2-yl-1,2-oxazolidin-5-yl]oxy-tert-butyl-dimethylsilane.
| Compound Name | [(3S,5S)-2-benzyl-5-phenyl-3-propan-2-yl-1,2-oxazolidin-5-yl]oxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 134923906 |
| Molecular Formula | C25H37NO2Si |
| Molecular Weight | 411.66 g/mol |
| Exact Mass | 411.26 |
| IUPAC Name | [(3S,5S)-2-benzyl-5-phenyl-3-propan-2-yl-1,2-oxazolidin-5-yl]oxy-tert-butyl-dimethylsilane |
| SMILES | CC(C)[C@@H]1C[C@](O[Si](C)(C)C(C)(C)C)(c2ccccc2)ON1Cc1ccccc1 |
| InChI | InChI=1S/C25H37NO2Si/c1-20(2)23-18-25(22-16-12-9-13-17-22,28-29(6,7)24(3,4)5)27-26(23)19-21-14-10-8-11-15-21/h8-17,20,23H,18-19H2,1-7H3/t23-,25-/m0/s1 |
| InChIKey | XQZZZMISFJWZTG-ZCYQVOJMSA-N |
| XLogP | 6.72 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.66 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|