C23H28N2O4 — CID 134923911
ethyl (4S)-8-benzyl-3,5,11-trimethyl-13-oxo-12-oxa-3,8-diazatricyclo[7.4.0.02,6]trideca-1(9),10-diene-4-carboxylate (PubChem CID 134923911) has the molecular formula C23H28N2O4 and a molecular weight of 396.49 g/mol. Its IUPAC name is ethyl (4S)-8-benzyl-3,5,11-trimethyl-13-oxo-12-oxa-3,8-diazatricyclo[7.4.0.02,6]trideca-1(9),10-diene-4-carboxylate.
| Compound Name | ethyl (4S)-8-benzyl-3,5,11-trimethyl-13-oxo-12-oxa-3,8-diazatricyclo[7.4.0.02,6]trideca-1(9),10-diene-4-carboxylate |
|---|---|
| PubChem CID | 134923911 |
| Molecular Formula | C23H28N2O4 |
| Molecular Weight | 396.49 g/mol |
| Exact Mass | 396.20 |
| IUPAC Name | ethyl (4S)-8-benzyl-3,5,11-trimethyl-13-oxo-12-oxa-3,8-diazatricyclo[7.4.0.02,6]trideca-1(9),10-diene-4-carboxylate |
| SMILES | CCOC(=O)[C@@H]1C(C)C2CN(Cc3ccccc3)c3cc(C)oc(=O)c3C2N1C |
| InChI | InChI=1S/C23H28N2O4/c1-5-28-23(27)20-15(3)17-13-25(12-16-9-7-6-8-10-16)18-11-14(2)29-22(26)19(18)21(17)24(20)4/h6-11,15,17,20-21H,5,12-13H2,1-4H3/t15?,17?,20-,21?/m0/s1 |
| InChIKey | LYTOURJZMQWBOD-IUXFZGPCSA-N |
| XLogP | 3.14 |
| TPSA | 62.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.49 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |