C16H19NO3 — CID 134923915
(E)-3-methoxy-2-(6-methyl-2,3,4,5-tetrahydropyridin-1-ium-1-yl)-3-oxo-1-phenylprop-1-en-1-olate (PubChem CID 134923915) has the molecular formula C16H19NO3 and a molecular weight of 273.33 g/mol. Its IUPAC name is (E)-3-methoxy-2-(6-methyl-2,3,4,5-tetrahydropyridin-1-ium-1-yl)-3-oxo-1-phenylprop-1-en-1-olate.
| Compound Name | (E)-3-methoxy-2-(6-methyl-2,3,4,5-tetrahydropyridin-1-ium-1-yl)-3-oxo-1-phenylprop-1-en-1-olate |
|---|---|
| PubChem CID | 134923915 |
| Molecular Formula | C16H19NO3 |
| Molecular Weight | 273.33 g/mol |
| Exact Mass | 273.14 |
| IUPAC Name | (E)-3-methoxy-2-(6-methyl-2,3,4,5-tetrahydropyridin-1-ium-1-yl)-3-oxo-1-phenylprop-1-en-1-olate |
| SMILES | COC(=O)/C(=C(\[O-])c1ccccc1)[N+]1=C(C)CCCC1 |
| InChI | InChI=1S/C16H19NO3/c1-12-8-6-7-11-17(12)14(16(19)20-2)15(18)13-9-4-3-5-10-13/h3-5,9-10H,6-8,11H2,1-2H3 |
| InChIKey | ZEFWVROBDVSZAG-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 52.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.33 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|