About methyl 4-nitro-3-phenyl-2-(triphenyl-λ5-phosphanylidene)pentanoate
methyl 4-nitro-3-phenyl-2-(triphenyl-λ5-phosphanylidene)pentanoate (PubChem CID 134923964) has the molecular formula C30H28NO4P
and a molecular weight of 497.53 g/mol. Its IUPAC name is methyl 4-nitro-3-phenyl-2-(triphenyl-λ5-phosphanylidene)pentanoate.
Molecular Properties
| Compound Name | methyl 4-nitro-3-phenyl-2-(triphenyl-λ5-phosphanylidene)pentanoate |
| PubChem CID | 134923964 |
| Molecular Formula | C30H28NO4P |
| Molecular Weight | 497.53 g/mol |
| Exact Mass | 497.18 |
| IUPAC Name | methyl 4-nitro-3-phenyl-2-(triphenyl-λ5-phosphanylidene)pentanoate |
| SMILES | COC(=O)C(C(c1ccccc1)C(C)[N+](=O)[O-])=P(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C30H28NO4P/c1-23(31(33)34)28(24-15-7-3-8-16-24)29(30(32)35-2)36(25-17-9-4-10-18-25,26-19-11-5-12-20-26)27-21-13-6-14-22-27/h3-23,28H,1-2H3 |
| InChIKey | SWUHELKKNVSOMQ-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 69.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 497.53 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze methyl 4-nitro-3-phenyl-2-(triphenyl-λ5-phosphanylidene)pentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-nitro-3-phenyl-2-(triphenyl-λ5-phosphanylidene)pentanoate?
The IUPAC name of methyl 4-nitro-3-phenyl-2-(triphenyl-λ5-phosphanylidene)pentanoate (CID 134923964) is methyl 4-nitro-3-phenyl-2-(triphenyl-λ5-phosphanylidene)pentanoate.
What is the SMILES notation for methyl 4-nitro-3-phenyl-2-(triphenyl-λ5-phosphanylidene)pentanoate?
The canonical SMILES for methyl 4-nitro-3-phenyl-2-(triphenyl-λ5-phosphanylidene)pentanoate is COC(=O)C(C(c1ccccc1)C(C)[N+](=O)[O-])=P(c1ccccc1)(c1ccccc1)c1ccccc1.
What is the InChIKey of methyl 4-nitro-3-phenyl-2-(triphenyl-λ5-phosphanylidene)pentanoate?
The InChIKey is SWUHELKKNVSOMQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C30H28NO4P/c1-23(31(33)34)28(24-15-7-3-8-16-24)29(30(32)35-2)36(25-17-9-4-10-18-25,26-19-11-5-12-20-26)27-21-13-6-14-22-27/h3-23,28H,1-2H3.
What are the key properties of methyl 4-nitro-3-phenyl-2-(triphenyl-λ5-phosphanylidene)pentanoate?
methyl 4-nitro-3-phenyl-2-(triphenyl-λ5-phosphanylidene)pentanoate has a molecular weight of 497.53 g/mol, XLogP of 4.77, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-nitro-3-phenyl-2-(triphenyl-λ5-phosphanylidene)pentanoate is sourced from PubChem (CID 134923964), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).