C22H27NO6 — CID 134924172
diethyl (3S,4R,8aR)-1-oxo-4-phenyl-3-propan-2-yl-3,4,6,8a-tetrahydropyrrolo[2,1-c][1,4]oxazine-7,8-dicarboxylate (PubChem CID 134924172) has the molecular formula C22H27NO6 and a molecular weight of 401.46 g/mol. Its IUPAC name is diethyl (3S,4R,8aR)-1-oxo-4-phenyl-3-propan-2-yl-3,4,6,8a-tetrahydropyrrolo[2,1-c][1,4]oxazine-7,8-dicarboxylate.
| Compound Name | diethyl (3S,4R,8aR)-1-oxo-4-phenyl-3-propan-2-yl-3,4,6,8a-tetrahydropyrrolo[2,1-c][1,4]oxazine-7,8-dicarboxylate |
|---|---|
| PubChem CID | 134924172 |
| Molecular Formula | C22H27NO6 |
| Molecular Weight | 401.46 g/mol |
| Exact Mass | 401.18 |
| IUPAC Name | diethyl (3S,4R,8aR)-1-oxo-4-phenyl-3-propan-2-yl-3,4,6,8a-tetrahydropyrrolo[2,1-c][1,4]oxazine-7,8-dicarboxylate |
| SMILES | CCOC(=O)C1=C(C(=O)OCC)[C@@H]2C(=O)O[C@@H](C(C)C)[C@@H](c3ccccc3)N2C1 |
| InChI | InChI=1S/C22H27NO6/c1-5-27-20(24)15-12-23-17(14-10-8-7-9-11-14)19(13(3)4)29-22(26)18(23)16(15)21(25)28-6-2/h7-11,13,17-19H,5-6,12H2,1-4H3/t17-,18-,19+/m1/s1 |
| InChIKey | BCOHBSVTFKRKMN-QRVBRYPASA-N |
| XLogP | 2.42 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.46 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|