C17H24O2Si — CID 134924204
2-[(2E)-hexa-2,5-dienyl]-5,6-dimethyl-3-trimethylsilylcyclohexa-2,5-diene-1,4-dione (PubChem CID 134924204) has the molecular formula C17H24O2Si and a molecular weight of 288.46 g/mol. Its IUPAC name is 2-[(2E)-hexa-2,5-dienyl]-5,6-dimethyl-3-trimethylsilylcyclohexa-2,5-diene-1,4-dione.
| Compound Name | 2-[(2E)-hexa-2,5-dienyl]-5,6-dimethyl-3-trimethylsilylcyclohexa-2,5-diene-1,4-dione |
|---|---|
| PubChem CID | 134924204 |
| Molecular Formula | C17H24O2Si |
| Molecular Weight | 288.46 g/mol |
| Exact Mass | 288.15 |
| IUPAC Name | 2-[(2E)-hexa-2,5-dienyl]-5,6-dimethyl-3-trimethylsilylcyclohexa-2,5-diene-1,4-dione |
| SMILES | C=CC/C=C/CC1=C([Si](C)(C)C)C(=O)C(C)=C(C)C1=O |
| InChI | InChI=1S/C17H24O2Si/c1-7-8-9-10-11-14-15(18)12(2)13(3)16(19)17(14)20(4,5)6/h7,9-10H,1,8,11H2,2-6H3/b10-9+ |
| InChIKey | FPSLCMPUJYVURF-MDZDMXLPSA-N |
| XLogP | 4.17 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.46 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|