C20H14N2O — CID 134924214
(2Z)-2-(pyren-4-ylmethylidene)-3,4-dihydropyrazol-2-ium-5-olate (PubChem CID 134924214) has the molecular formula C20H14N2O and a molecular weight of 298.35 g/mol. Its IUPAC name is (2Z)-2-(pyren-4-ylmethylidene)-3,4-dihydropyrazol-2-ium-5-olate.
| Compound Name | (2Z)-2-(pyren-4-ylmethylidene)-3,4-dihydropyrazol-2-ium-5-olate |
|---|---|
| PubChem CID | 134924214 |
| Molecular Formula | C20H14N2O |
| Molecular Weight | 298.35 g/mol |
| Exact Mass | 298.11 |
| IUPAC Name | (2Z)-2-(pyren-4-ylmethylidene)-3,4-dihydropyrazol-2-ium-5-olate |
| SMILES | [O-]C1=N/[N+](=C\c2cc3cccc4ccc5cccc2c5c43)CC1 |
| InChI | InChI=1S/C20H14N2O/c23-18-9-10-22(21-18)12-16-11-15-5-1-3-13-7-8-14-4-2-6-17(16)20(14)19(13)15/h1-8,11-12H,9-10H2/b22-12- |
| InChIKey | MJYYOYYPJLTTSQ-UUYOSTAYSA-N |
| XLogP | 3.09 |
| TPSA | 38.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.35 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|