C13H16O4 — CID 134924318
2-methyl-2-(2,4,5-trimethyl-3,6-dioxocyclohexa-1,4-dien-1-yl)propanoic acid (PubChem CID 134924318) has the molecular formula C13H16O4 and a molecular weight of 236.27 g/mol. Its IUPAC name is 2-methyl-2-(2,4,5-trimethyl-3,6-dioxocyclohexa-1,4-dien-1-yl)propanoic acid.
| Compound Name | 2-methyl-2-(2,4,5-trimethyl-3,6-dioxocyclohexa-1,4-dien-1-yl)propanoic acid |
|---|---|
| PubChem CID | 134924318 |
| Molecular Formula | C13H16O4 |
| Molecular Weight | 236.27 g/mol |
| Exact Mass | 236.10 |
| IUPAC Name | 2-methyl-2-(2,4,5-trimethyl-3,6-dioxocyclohexa-1,4-dien-1-yl)propanoic acid |
| SMILES | CC1=C(C)C(=O)C(C(C)(C)C(=O)O)=C(C)C1=O |
| InChI | InChI=1S/C13H16O4/c1-6-7(2)11(15)9(8(3)10(6)14)13(4,5)12(16)17/h1-5H3,(H,16,17) |
| InChIKey | OCJQXRMEGBNONO-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.27 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|