About 2-aminopentanedinitrile
2-aminopentanedinitrile (PubChem CID 13492441) has the molecular formula C5H7N3
and a molecular weight of 109.13 g/mol. Its IUPAC name is 2-aminopentanedinitrile.
Molecular Properties
| Compound Name | 2-aminopentanedinitrile |
| PubChem CID | 13492441 |
| Molecular Formula | C5H7N3 |
| Molecular Weight | 109.13 g/mol |
| Exact Mass | 109.06 |
| IUPAC Name | 2-aminopentanedinitrile |
| SMILES | N#CCCC(N)C#N |
| InChI | InChI=1S/C5H7N3/c6-3-1-2-5(8)4-7/h5H,1-2,8H2 |
| InChIKey | OEJCZBUJXIJRST-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 73.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 109.13 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-aminopentanedinitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-aminopentanedinitrile?
The IUPAC name of 2-aminopentanedinitrile (CID 13492441) is 2-aminopentanedinitrile.
What is the SMILES notation for 2-aminopentanedinitrile?
The canonical SMILES for 2-aminopentanedinitrile is N#CCCC(N)C#N.
What is the InChIKey of 2-aminopentanedinitrile?
The InChIKey is OEJCZBUJXIJRST-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H7N3/c6-3-1-2-5(8)4-7/h5H,1-2,8H2.
What are the key properties of 2-aminopentanedinitrile?
2-aminopentanedinitrile has a molecular weight of 109.13 g/mol, XLogP of 0.14, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-aminopentanedinitrile is sourced from PubChem (CID 13492441), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).