C19H23NO4 — CID 134924526
ethyl (3S,4R,8aR)-1-oxo-4-phenyl-3-propan-2-yl-3,4,6,8a-tetrahydropyrrolo[2,1-c][1,4]oxazine-8-carboxylate (PubChem CID 134924526) has the molecular formula C19H23NO4 and a molecular weight of 329.40 g/mol. Its IUPAC name is ethyl (3S,4R,8aR)-1-oxo-4-phenyl-3-propan-2-yl-3,4,6,8a-tetrahydropyrrolo[2,1-c][1,4]oxazine-8-carboxylate.
| Compound Name | ethyl (3S,4R,8aR)-1-oxo-4-phenyl-3-propan-2-yl-3,4,6,8a-tetrahydropyrrolo[2,1-c][1,4]oxazine-8-carboxylate |
|---|---|
| PubChem CID | 134924526 |
| Molecular Formula | C19H23NO4 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.16 |
| IUPAC Name | ethyl (3S,4R,8aR)-1-oxo-4-phenyl-3-propan-2-yl-3,4,6,8a-tetrahydropyrrolo[2,1-c][1,4]oxazine-8-carboxylate |
| SMILES | CCOC(=O)C1=CCN2[C@H]1C(=O)O[C@@H](C(C)C)[C@H]2c1ccccc1 |
| InChI | InChI=1S/C19H23NO4/c1-4-23-18(21)14-10-11-20-15(13-8-6-5-7-9-13)17(12(2)3)24-19(22)16(14)20/h5-10,12,15-17H,4,11H2,1-3H3/t15-,16-,17+/m1/s1 |
| InChIKey | JCUQVTULKGRHRM-ZACQAIPSSA-N |
| XLogP | 2.48 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |