C15H21IO3 — CID 134924623
(3S,5aS,7R,9S,9aS)-7-iodo-3,5a,9-trimethyl-3a,4,5,6,7,9,9a,9b-octahydro-3H-benzo[g][1]benzofuran-2,8-dione (PubChem CID 134924623) has the molecular formula C15H21IO3 and a molecular weight of 376.23 g/mol. Its IUPAC name is (3S,5aS,7R,9S,9aS)-7-iodo-3,5a,9-trimethyl-3a,4,5,6,7,9,9a,9b-octahydro-3H-benzo[g][1]benzofuran-2,8-dione.
| Compound Name | (3S,5aS,7R,9S,9aS)-7-iodo-3,5a,9-trimethyl-3a,4,5,6,7,9,9a,9b-octahydro-3H-benzo[g][1]benzofuran-2,8-dione |
|---|---|
| PubChem CID | 134924623 |
| Molecular Formula | C15H21IO3 |
| Molecular Weight | 376.23 g/mol |
| Exact Mass | 376.05 |
| IUPAC Name | (3S,5aS,7R,9S,9aS)-7-iodo-3,5a,9-trimethyl-3a,4,5,6,7,9,9a,9b-octahydro-3H-benzo[g][1]benzofuran-2,8-dione |
| SMILES | C[C@@H]1C(=O)OC2C1CC[C@@]1(C)C[C@@H](I)C(=O)[C@@H](C)[C@H]21 |
| InChI | InChI=1S/C15H21IO3/c1-7-9-4-5-15(3)6-10(16)12(17)8(2)11(15)13(9)19-14(7)18/h7-11,13H,4-6H2,1-3H3/t7-,8-,9?,10+,11+,13?,15-/m0/s1 |
| InChIKey | ZLIHROUPHBWRFD-PHAWIGPBSA-N |
| XLogP | 2.99 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.23 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|