About [(3S,5R)-2-benzyl-3-ethyl-1,2-oxazolidin-5-yl]oxy-tert-butyl-dimethylsilane
[(3S,5R)-2-benzyl-3-ethyl-1,2-oxazolidin-5-yl]oxy-tert-butyl-dimethylsilane (PubChem CID 134924653) has the molecular formula C18H31NO2Si
and a molecular weight of 321.54 g/mol. Its IUPAC name is [(3S,5R)-2-benzyl-3-ethyl-1,2-oxazolidin-5-yl]oxy-tert-butyl-dimethylsilane.
Molecular Properties
| Compound Name | [(3S,5R)-2-benzyl-3-ethyl-1,2-oxazolidin-5-yl]oxy-tert-butyl-dimethylsilane |
| PubChem CID | 134924653 |
| Molecular Formula | C18H31NO2Si |
| Molecular Weight | 321.54 g/mol |
| Exact Mass | 321.21 |
| IUPAC Name | [(3S,5R)-2-benzyl-3-ethyl-1,2-oxazolidin-5-yl]oxy-tert-butyl-dimethylsilane |
| SMILES | CC[C@H]1C[C@@H](O[Si](C)(C)C(C)(C)C)ON1Cc1ccccc1 |
| InChI | InChI=1S/C18H31NO2Si/c1-7-16-13-17(21-22(5,6)18(2,3)4)20-19(16)14-15-11-9-8-10-12-15/h8-12,16-17H,7,13-14H2,1-6H3/t16-,17+/m0/s1 |
| InChIKey | KFILPRYUFMNTTF-DLBZAZTESA-N |
| XLogP | 4.95 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.54 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze [(3S,5R)-2-benzyl-3-ethyl-1,2-oxazolidin-5-yl]oxy-tert-butyl-dimethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3S,5R)-2-benzyl-3-ethyl-1,2-oxazolidin-5-yl]oxy-tert-butyl-dimethylsilane?
The IUPAC name of [(3S,5R)-2-benzyl-3-ethyl-1,2-oxazolidin-5-yl]oxy-tert-butyl-dimethylsilane (CID 134924653) is [(3S,5R)-2-benzyl-3-ethyl-1,2-oxazolidin-5-yl]oxy-tert-butyl-dimethylsilane.
What is the SMILES notation for [(3S,5R)-2-benzyl-3-ethyl-1,2-oxazolidin-5-yl]oxy-tert-butyl-dimethylsilane?
The canonical SMILES for [(3S,5R)-2-benzyl-3-ethyl-1,2-oxazolidin-5-yl]oxy-tert-butyl-dimethylsilane is CC[C@H]1C[C@@H](O[Si](C)(C)C(C)(C)C)ON1Cc1ccccc1.
What is the InChIKey of [(3S,5R)-2-benzyl-3-ethyl-1,2-oxazolidin-5-yl]oxy-tert-butyl-dimethylsilane?
The InChIKey is KFILPRYUFMNTTF-DLBZAZTESA-N. The full InChI is InChI=1S/C18H31NO2Si/c1-7-16-13-17(21-22(5,6)18(2,3)4)20-19(16)14-15-11-9-8-10-12-15/h8-12,16-17H,7,13-14H2,1-6H3/t16-,17+/m0/s1.
What are the key properties of [(3S,5R)-2-benzyl-3-ethyl-1,2-oxazolidin-5-yl]oxy-tert-butyl-dimethylsilane?
[(3S,5R)-2-benzyl-3-ethyl-1,2-oxazolidin-5-yl]oxy-tert-butyl-dimethylsilane has a molecular weight of 321.54 g/mol, XLogP of 4.95, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(3S,5R)-2-benzyl-3-ethyl-1,2-oxazolidin-5-yl]oxy-tert-butyl-dimethylsilane is sourced from PubChem (CID 134924653), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).