C26H37NO4Si — CID 134924673
N-benzhydryl-1-[(4S,5S)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]methanimine oxide (PubChem CID 134924673) has the molecular formula C26H37NO4Si and a molecular weight of 455.67 g/mol. Its IUPAC name is N-benzhydryl-1-[(4S,5S)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]methanimine oxide.
| Compound Name | N-benzhydryl-1-[(4S,5S)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]methanimine oxide |
|---|---|
| PubChem CID | 134924673 |
| Molecular Formula | C26H37NO4Si |
| Molecular Weight | 455.67 g/mol |
| Exact Mass | 455.25 |
| IUPAC Name | N-benzhydryl-1-[(4S,5S)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]methanimine oxide |
| SMILES | CC1(C)O[C@@H](/C=[N+](\[O-])C(c2ccccc2)c2ccccc2)[C@H](CO[Si](C)(C)C(C)(C)C)O1 |
| InChI | InChI=1S/C26H37NO4Si/c1-25(2,3)32(6,7)29-19-23-22(30-26(4,5)31-23)18-27(28)24(20-14-10-8-11-15-20)21-16-12-9-13-17-21/h8-18,22-24H,19H2,1-7H3/b27-18-/t22-,23-/m0/s1 |
| InChIKey | CDBNLPJOYOVMLV-AXJPGLEXSA-N |
| XLogP | 5.90 |
| TPSA | 53.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.67 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|