C23H30O5S — CID 134925026
[(4aS,6aS,10aR,10bS)-3,3,6a-trimethyl-8-oxo-9-phenylsulfanyl-1,4a,5,6,7,10,10a,10b-octahydronaphtho[2,1-d][1,3]dioxin-9-yl] acetate (PubChem CID 134925026) has the molecular formula C23H30O5S and a molecular weight of 418.56 g/mol. Its IUPAC name is [(4aS,6aS,10aR,10bS)-3,3,6a-trimethyl-8-oxo-9-phenylsulfanyl-1,4a,5,6,7,10,10a,10b-octahydronaphtho[2,1-d][1,3]dioxin-9-yl] acetate.
| Compound Name | [(4aS,6aS,10aR,10bS)-3,3,6a-trimethyl-8-oxo-9-phenylsulfanyl-1,4a,5,6,7,10,10a,10b-octahydronaphtho[2,1-d][1,3]dioxin-9-yl] acetate |
|---|---|
| PubChem CID | 134925026 |
| Molecular Formula | C23H30O5S |
| Molecular Weight | 418.56 g/mol |
| Exact Mass | 418.18 |
| IUPAC Name | [(4aS,6aS,10aR,10bS)-3,3,6a-trimethyl-8-oxo-9-phenylsulfanyl-1,4a,5,6,7,10,10a,10b-octahydronaphtho[2,1-d][1,3]dioxin-9-yl] acetate |
| SMILES | CC(=O)OC1(Sc2ccccc2)C[C@@H]2[C@H]3COC(C)(C)O[C@H]3CC[C@@]2(C)CC1=O |
| InChI | InChI=1S/C23H30O5S/c1-15(24)27-23(29-16-8-6-5-7-9-16)12-18-17-14-26-21(2,3)28-19(17)10-11-22(18,4)13-20(23)25/h5-9,17-19H,10-14H2,1-4H3/t17-,18-,19+,22+,23?/m1/s1 |
| InChIKey | ZNIZFWKJSBADSP-ILJQEWAWSA-N |
| XLogP | 4.59 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.56 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|