C15H24O4S — CID 134925131
ethyl 6-(2,2-dimethylpropanoyl)-3,4-dimethyl-1-oxo-2,5-dihydrothiopyran-6-carboxylate (PubChem CID 134925131) has the molecular formula C15H24O4S and a molecular weight of 300.42 g/mol. Its IUPAC name is ethyl 6-(2,2-dimethylpropanoyl)-3,4-dimethyl-1-oxo-2,5-dihydrothiopyran-6-carboxylate.
| Compound Name | ethyl 6-(2,2-dimethylpropanoyl)-3,4-dimethyl-1-oxo-2,5-dihydrothiopyran-6-carboxylate |
|---|---|
| PubChem CID | 134925131 |
| Molecular Formula | C15H24O4S |
| Molecular Weight | 300.42 g/mol |
| Exact Mass | 300.14 |
| IUPAC Name | ethyl 6-(2,2-dimethylpropanoyl)-3,4-dimethyl-1-oxo-2,5-dihydrothiopyran-6-carboxylate |
| SMILES | CCOC(=O)C1(C(=O)C(C)(C)C)CC(C)=C(C)CS1=O |
| InChI | InChI=1S/C15H24O4S/c1-7-19-13(17)15(12(16)14(4,5)6)8-10(2)11(3)9-20(15)18/h7-9H2,1-6H3 |
| InChIKey | BLKIGWPIDSRFDQ-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.42 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|