C14H18ClNO4S — CID 134925218
dimethyl-[(2E,4E)-5-(4-methylsulfanylphenyl)penta-2,4-dienylidene]azanium perchlorate (PubChem CID 134925218) has the molecular formula C14H18ClNO4S and a molecular weight of 331.82 g/mol. Its IUPAC name is dimethyl-[(2E,4E)-5-(4-methylsulfanylphenyl)penta-2,4-dienylidene]azanium perchlorate.
| Compound Name | dimethyl-[(2E,4E)-5-(4-methylsulfanylphenyl)penta-2,4-dienylidene]azanium perchlorate |
|---|---|
| PubChem CID | 134925218 |
| Molecular Formula | C14H18ClNO4S |
| Molecular Weight | 331.82 g/mol |
| Exact Mass | 331.06 |
| IUPAC Name | dimethyl-[(2E,4E)-5-(4-methylsulfanylphenyl)penta-2,4-dienylidene]azanium perchlorate |
| SMILES | CSc1ccc(/C=C/C=C/C=[N+](C)C)cc1.[O-][Cl+3]([O-])([O-])[O-] |
| InChI | InChI=1S/C14H18NS.ClHO4/c1-15(2)12-6-4-5-7-13-8-10-14(16-3)11-9-13;2-1(3,4)5/h4-12H,1-3H3;(H,2,3,4,5)/q+1;/p-1/b6-4+,7-5+; |
| InChIKey | DQVPPEURGPWADX-GWDFKRKCSA-M |
| XLogP | -1.44 |
| TPSA | 95.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.82 |
| LogP ≤ 5 | -1.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|