C15H24S — CID 134925316
3-[(2R)-2,6-dimethylhept-5-enyl]-2-thiabicyclo[2.2.1]hept-5-ene (PubChem CID 134925316) has the molecular formula C15H24S and a molecular weight of 236.42 g/mol. Its IUPAC name is 3-[(2R)-2,6-dimethylhept-5-enyl]-2-thiabicyclo[2.2.1]hept-5-ene.
| Compound Name | 3-[(2R)-2,6-dimethylhept-5-enyl]-2-thiabicyclo[2.2.1]hept-5-ene |
|---|---|
| PubChem CID | 134925316 |
| Molecular Formula | C15H24S |
| Molecular Weight | 236.42 g/mol |
| Exact Mass | 236.16 |
| IUPAC Name | 3-[(2R)-2,6-dimethylhept-5-enyl]-2-thiabicyclo[2.2.1]hept-5-ene |
| SMILES | CC(C)=CCC[C@@H](C)CC1SC2C=CC1C2 |
| InChI | InChI=1S/C15H24S/c1-11(2)5-4-6-12(3)9-15-13-7-8-14(10-13)16-15/h5,7-8,12-15H,4,6,9-10H2,1-3H3/t12-,13?,14?,15?/m1/s1 |
| InChIKey | DSCSKSSXLLVHBW-AUXXQLBISA-N |
| XLogP | 4.82 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.42 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|