C16H19NO3 — CID 134925356
(3S,3aS,7aR)-3-acetyl-1-benzyl-2,3,3a,4,5,7a-hexahydropyrano[3,4-b]pyrrol-7-one (PubChem CID 134925356) has the molecular formula C16H19NO3 and a molecular weight of 273.33 g/mol. Its IUPAC name is (3S,3aS,7aR)-3-acetyl-1-benzyl-2,3,3a,4,5,7a-hexahydropyrano[3,4-b]pyrrol-7-one.
| Compound Name | (3S,3aS,7aR)-3-acetyl-1-benzyl-2,3,3a,4,5,7a-hexahydropyrano[3,4-b]pyrrol-7-one |
|---|---|
| PubChem CID | 134925356 |
| Molecular Formula | C16H19NO3 |
| Molecular Weight | 273.33 g/mol |
| Exact Mass | 273.14 |
| IUPAC Name | (3S,3aS,7aR)-3-acetyl-1-benzyl-2,3,3a,4,5,7a-hexahydropyrano[3,4-b]pyrrol-7-one |
| SMILES | CC(=O)[C@@H]1CN(Cc2ccccc2)[C@H]2C(=O)OCC[C@@H]12 |
| InChI | InChI=1S/C16H19NO3/c1-11(18)14-10-17(9-12-5-3-2-4-6-12)15-13(14)7-8-20-16(15)19/h2-6,13-15H,7-10H2,1H3/t13-,14-,15+/m0/s1 |
| InChIKey | BXKKJJJODICBHB-SOUVJXGZSA-N |
| XLogP | 1.64 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.33 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |