About 4-phenylpent-4-ene-1-sulfonate;pyridin-1-ium
4-phenylpent-4-ene-1-sulfonate;pyridin-1-ium (PubChem CID 134925440) has the molecular formula C16H19NO3S
and a molecular weight of 305.40 g/mol. Its IUPAC name is 4-phenylpent-4-ene-1-sulfonate;pyridin-1-ium.
Molecular Properties
| Compound Name | 4-phenylpent-4-ene-1-sulfonate;pyridin-1-ium |
| PubChem CID | 134925440 |
| Molecular Formula | C16H19NO3S |
| Molecular Weight | 305.40 g/mol |
| Exact Mass | 305.11 |
| IUPAC Name | 4-phenylpent-4-ene-1-sulfonate;pyridin-1-ium |
| SMILES | C=C(CCCS(=O)(=O)[O-])c1ccccc1.c1cc[nH+]cc1 |
| InChI | InChI=1S/C11H14O3S.C5H5N/c1-10(6-5-9-15(12,13)14)11-7-3-2-4-8-11;1-2-4-6-5-3-1/h2-4,7-8H,1,5-6,9H2,(H,12,13,14);1-5H |
| InChIKey | FTDRLFMIXSYNFD-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 71.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.40 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 4-phenylpent-4-ene-1-sulfonate;pyridin-1-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-phenylpent-4-ene-1-sulfonate;pyridin-1-ium?
The IUPAC name of 4-phenylpent-4-ene-1-sulfonate;pyridin-1-ium (CID 134925440) is 4-phenylpent-4-ene-1-sulfonate;pyridin-1-ium.
What is the SMILES notation for 4-phenylpent-4-ene-1-sulfonate;pyridin-1-ium?
The canonical SMILES for 4-phenylpent-4-ene-1-sulfonate;pyridin-1-ium is C=C(CCCS(=O)(=O)[O-])c1ccccc1.c1cc[nH+]cc1.
What is the InChIKey of 4-phenylpent-4-ene-1-sulfonate;pyridin-1-ium?
The InChIKey is FTDRLFMIXSYNFD-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14O3S.C5H5N/c1-10(6-5-9-15(12,13)14)11-7-3-2-4-8-11;1-2-4-6-5-3-1/h2-4,7-8H,1,5-6,9H2,(H,12,13,14);1-5H.
What are the key properties of 4-phenylpent-4-ene-1-sulfonate;pyridin-1-ium?
4-phenylpent-4-ene-1-sulfonate;pyridin-1-ium has a molecular weight of 305.40 g/mol, XLogP of 2.53, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-phenylpent-4-ene-1-sulfonate;pyridin-1-ium is sourced from PubChem (CID 134925440), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).