About methyl 4-[(7R)-3-oxo-7-phenyl-2,7-dihydro-1H-pyrazolo[1,2-a]pyrazol-6-yl]benzoate
methyl 4-[(7R)-3-oxo-7-phenyl-2,7-dihydro-1H-pyrazolo[1,2-a]pyrazol-6-yl]benzoate (PubChem CID 134925537) has the molecular formula C20H18N2O3
and a molecular weight of 334.38 g/mol. Its IUPAC name is methyl 4-[(7R)-3-oxo-7-phenyl-2,7-dihydro-1H-pyrazolo[1,2-a]pyrazol-6-yl]benzoate.
Molecular Properties
| Compound Name | methyl 4-[(7R)-3-oxo-7-phenyl-2,7-dihydro-1H-pyrazolo[1,2-a]pyrazol-6-yl]benzoate |
| PubChem CID | 134925537 |
| Molecular Formula | C20H18N2O3 |
| Molecular Weight | 334.38 g/mol |
| Exact Mass | 334.13 |
| IUPAC Name | methyl 4-[(7R)-3-oxo-7-phenyl-2,7-dihydro-1H-pyrazolo[1,2-a]pyrazol-6-yl]benzoate |
| SMILES | COC(=O)c1ccc(C2=CN3C(=O)CCN3[C@@H]2c2ccccc2)cc1 |
| InChI | InChI=1S/C20H18N2O3/c1-25-20(24)16-9-7-14(8-10-16)17-13-22-18(23)11-12-21(22)19(17)15-5-3-2-4-6-15/h2-10,13,19H,11-12H2,1H3/t19-/m1/s1 |
| InChIKey | HWUMGMKUJIFTQZ-LJQANCHMSA-N |
| XLogP | 3.02 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.38 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl 4-[(7R)-3-oxo-7-phenyl-2,7-dihydro-1H-pyrazolo[1,2-a]pyrazol-6-yl]benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-[(7R)-3-oxo-7-phenyl-2,7-dihydro-1H-pyrazolo[1,2-a]pyrazol-6-yl]benzoate?
The IUPAC name of methyl 4-[(7R)-3-oxo-7-phenyl-2,7-dihydro-1H-pyrazolo[1,2-a]pyrazol-6-yl]benzoate (CID 134925537) is methyl 4-[(7R)-3-oxo-7-phenyl-2,7-dihydro-1H-pyrazolo[1,2-a]pyrazol-6-yl]benzoate.
What is the SMILES notation for methyl 4-[(7R)-3-oxo-7-phenyl-2,7-dihydro-1H-pyrazolo[1,2-a]pyrazol-6-yl]benzoate?
The canonical SMILES for methyl 4-[(7R)-3-oxo-7-phenyl-2,7-dihydro-1H-pyrazolo[1,2-a]pyrazol-6-yl]benzoate is COC(=O)c1ccc(C2=CN3C(=O)CCN3[C@@H]2c2ccccc2)cc1.
What is the InChIKey of methyl 4-[(7R)-3-oxo-7-phenyl-2,7-dihydro-1H-pyrazolo[1,2-a]pyrazol-6-yl]benzoate?
The InChIKey is HWUMGMKUJIFTQZ-LJQANCHMSA-N. The full InChI is InChI=1S/C20H18N2O3/c1-25-20(24)16-9-7-14(8-10-16)17-13-22-18(23)11-12-21(22)19(17)15-5-3-2-4-6-15/h2-10,13,19H,11-12H2,1H3/t19-/m1/s1.
What are the key properties of methyl 4-[(7R)-3-oxo-7-phenyl-2,7-dihydro-1H-pyrazolo[1,2-a]pyrazol-6-yl]benzoate?
methyl 4-[(7R)-3-oxo-7-phenyl-2,7-dihydro-1H-pyrazolo[1,2-a]pyrazol-6-yl]benzoate has a molecular weight of 334.38 g/mol, XLogP of 3.02, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-[(7R)-3-oxo-7-phenyl-2,7-dihydro-1H-pyrazolo[1,2-a]pyrazol-6-yl]benzoate is sourced from PubChem (CID 134925537), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).