C16H28N2 — CID 134925596
(Z,1R,4S)-N-[(E)-3,3-dimethylbutan-2-ylideneamino]-1,3,3-trimethylbicyclo[2.2.1]heptan-2-imine (PubChem CID 134925596) has the molecular formula C16H28N2 and a molecular weight of 248.41 g/mol. Its IUPAC name is (Z,1R,4S)-N-[(E)-3,3-dimethylbutan-2-ylideneamino]-1,3,3-trimethylbicyclo[2.2.1]heptan-2-imine.
| Compound Name | (Z,1R,4S)-N-[(E)-3,3-dimethylbutan-2-ylideneamino]-1,3,3-trimethylbicyclo[2.2.1]heptan-2-imine |
|---|---|
| PubChem CID | 134925596 |
| Molecular Formula | C16H28N2 |
| Molecular Weight | 248.41 g/mol |
| Exact Mass | 248.23 |
| IUPAC Name | (Z,1R,4S)-N-[(E)-3,3-dimethylbutan-2-ylideneamino]-1,3,3-trimethylbicyclo[2.2.1]heptan-2-imine |
| SMILES | C/C(=N\N=C1/C(C)(C)[C@H]2CC[C@]1(C)C2)C(C)(C)C |
| InChI | InChI=1S/C16H28N2/c1-11(14(2,3)4)17-18-13-15(5,6)12-8-9-16(13,7)10-12/h12H,8-10H2,1-7H3/b17-11+,18-13+/t12-,16+/m0/s1 |
| InChIKey | VMEROUZMQDXYKO-YIWMGENBSA-N |
| XLogP | 4.70 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.41 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|