C14H12N2O — CID 134925645
(2Z)-2-(naphthalen-1-ylmethylidene)-3,4-dihydropyrazol-2-ium-5-olate (PubChem CID 134925645) has the molecular formula C14H12N2O and a molecular weight of 224.26 g/mol. Its IUPAC name is (2Z)-2-(naphthalen-1-ylmethylidene)-3,4-dihydropyrazol-2-ium-5-olate.
| Compound Name | (2Z)-2-(naphthalen-1-ylmethylidene)-3,4-dihydropyrazol-2-ium-5-olate |
|---|---|
| PubChem CID | 134925645 |
| Molecular Formula | C14H12N2O |
| Molecular Weight | 224.26 g/mol |
| Exact Mass | 224.09 |
| IUPAC Name | (2Z)-2-(naphthalen-1-ylmethylidene)-3,4-dihydropyrazol-2-ium-5-olate |
| SMILES | [O-]C1=N/[N+](=C\c2cccc3ccccc23)CC1 |
| InChI | InChI=1S/C14H12N2O/c17-14-8-9-16(15-14)10-12-6-3-5-11-4-1-2-7-13(11)12/h1-7,10H,8-9H2/b16-10- |
| InChIKey | STVDYDYGZBSCLQ-YBEGLDIGSA-N |
| XLogP | 1.35 |
| TPSA | 38.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.26 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|