C25H43NO5Si — CID 134925738
tert-butyl 3-[benzyl-[tert-butyl(dimethyl)silyl]oxyamino]-3-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]propanoate (PubChem CID 134925738) has the molecular formula C25H43NO5Si and a molecular weight of 465.71 g/mol. Its IUPAC name is tert-butyl 3-[benzyl-[tert-butyl(dimethyl)silyl]oxyamino]-3-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]propanoate.
| Compound Name | tert-butyl 3-[benzyl-[tert-butyl(dimethyl)silyl]oxyamino]-3-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]propanoate |
|---|---|
| PubChem CID | 134925738 |
| Molecular Formula | C25H43NO5Si |
| Molecular Weight | 465.71 g/mol |
| Exact Mass | 465.29 |
| IUPAC Name | tert-butyl 3-[benzyl-[tert-butyl(dimethyl)silyl]oxyamino]-3-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]propanoate |
| SMILES | CC(C)(C)OC(=O)CC([C@H]1COC(C)(C)O1)N(Cc1ccccc1)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C25H43NO5Si/c1-23(2,3)30-22(27)16-20(21-18-28-25(7,8)29-21)26(17-19-14-12-11-13-15-19)31-32(9,10)24(4,5)6/h11-15,20-21H,16-18H2,1-10H3/t20?,21-/m1/s1 |
| InChIKey | NKSFPAOKWUPLKU-BPGUCPLFSA-N |
| XLogP | 5.68 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.71 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|