C18H40N2 — CID 134925867
(5R,6S)-5-N,6-N-ditert-butyldecane-5,6-diamine (PubChem CID 134925867) has the molecular formula C18H40N2 and a molecular weight of 284.53 g/mol. Its IUPAC name is (5R,6S)-5-N,6-N-ditert-butyldecane-5,6-diamine.
| Compound Name | (5R,6S)-5-N,6-N-ditert-butyldecane-5,6-diamine |
|---|---|
| PubChem CID | 134925867 |
| Molecular Formula | C18H40N2 |
| Molecular Weight | 284.53 g/mol |
| Exact Mass | 284.32 |
| IUPAC Name | (5R,6S)-5-N,6-N-ditert-butyldecane-5,6-diamine |
| SMILES | CCCC[C@H](NC(C)(C)C)[C@@H](CCCC)NC(C)(C)C |
| InChI | InChI=1S/C18H40N2/c1-9-11-13-15(19-17(3,4)5)16(14-12-10-2)20-18(6,7)8/h15-16,19-20H,9-14H2,1-8H3/t15-,16+ |
| InChIKey | JDSFHAATDQBUBM-IYBDPMFKSA-N |
| XLogP | 4.88 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.53 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |