C11F14 — CID 13492589
2,3,4,5,7,7,8-heptafluoro-8-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)bicyclo[4.2.0]octa-1(6),2,4-triene (PubChem CID 13492589) has the molecular formula C11F14 and a molecular weight of 398.09 g/mol. Its IUPAC name is 2,3,4,5,7,7,8-heptafluoro-8-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)bicyclo[4.2.0]octa-1(6),2,4-triene.
| Compound Name | 2,3,4,5,7,7,8-heptafluoro-8-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)bicyclo[4.2.0]octa-1(6),2,4-triene |
|---|---|
| PubChem CID | 13492589 |
| Molecular Formula | C11F14 |
| Molecular Weight | 398.09 g/mol |
| Exact Mass | 397.98 |
| IUPAC Name | 2,3,4,5,7,7,8-heptafluoro-8-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)bicyclo[4.2.0]octa-1(6),2,4-triene |
| SMILES | Fc1c(F)c(F)c2c(c1F)C(F)(F)C2(F)C(F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C11F14/c12-3-1-2(4(13)6(15)5(3)14)8(17,18)7(1,16)9(19,10(20,21)22)11(23,24)25 |
| InChIKey | QTYGPRCHPTTYIL-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.09 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|