About dodeca-1,11-diene-6,7-diamine
dodeca-1,11-diene-6,7-diamine (PubChem CID 134926081) has the molecular formula C12H24N2
and a molecular weight of 196.34 g/mol. Its IUPAC name is dodeca-1,11-diene-6,7-diamine.
Molecular Properties
| Compound Name | dodeca-1,11-diene-6,7-diamine |
| PubChem CID | 134926081 |
| Molecular Formula | C12H24N2 |
| Molecular Weight | 196.34 g/mol |
| Exact Mass | 196.19 |
| IUPAC Name | dodeca-1,11-diene-6,7-diamine |
| SMILES | C=CCCCC(N)C(N)CCCC=C |
| InChI | InChI=1S/C12H24N2/c1-3-5-7-9-11(13)12(14)10-8-6-4-2/h3-4,11-12H,1-2,5-10,13-14H2 |
| InChIKey | ZEEUJZCLAYSKEJ-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.34 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze dodeca-1,11-diene-6,7-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dodeca-1,11-diene-6,7-diamine?
The IUPAC name of dodeca-1,11-diene-6,7-diamine (CID 134926081) is dodeca-1,11-diene-6,7-diamine.
What is the SMILES notation for dodeca-1,11-diene-6,7-diamine?
The canonical SMILES for dodeca-1,11-diene-6,7-diamine is C=CCCCC(N)C(N)CCCC=C.
What is the InChIKey of dodeca-1,11-diene-6,7-diamine?
The InChIKey is ZEEUJZCLAYSKEJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H24N2/c1-3-5-7-9-11(13)12(14)10-8-6-4-2/h3-4,11-12H,1-2,5-10,13-14H2.
What are the key properties of dodeca-1,11-diene-6,7-diamine?
dodeca-1,11-diene-6,7-diamine has a molecular weight of 196.34 g/mol, XLogP of 2.35, 9 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for dodeca-1,11-diene-6,7-diamine is sourced from PubChem (CID 134926081), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).