C23H33NO3Si2 — CID 134926260
benzyl 3-phenyl-2-trimethylsilyl-3-trimethylsilyloxyazetidine-1-carboxylate (PubChem CID 134926260) has the molecular formula C23H33NO3Si2 and a molecular weight of 427.69 g/mol. Its IUPAC name is benzyl 3-phenyl-2-trimethylsilyl-3-trimethylsilyloxyazetidine-1-carboxylate.
| Compound Name | benzyl 3-phenyl-2-trimethylsilyl-3-trimethylsilyloxyazetidine-1-carboxylate |
|---|---|
| PubChem CID | 134926260 |
| Molecular Formula | C23H33NO3Si2 |
| Molecular Weight | 427.69 g/mol |
| Exact Mass | 427.20 |
| IUPAC Name | benzyl 3-phenyl-2-trimethylsilyl-3-trimethylsilyloxyazetidine-1-carboxylate |
| SMILES | C[Si](C)(C)OC1(c2ccccc2)CN(C(=O)OCc2ccccc2)C1[Si](C)(C)C |
| InChI | InChI=1S/C23H33NO3Si2/c1-28(2,3)21-23(27-29(4,5)6,20-15-11-8-12-16-20)18-24(21)22(25)26-17-19-13-9-7-10-14-19/h7-16,21H,17-18H2,1-6H3 |
| InChIKey | JQQWAMZKLXPIKU-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.69 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|