About [(1R,2S)-1-oxo-1,3-dithiolan-2-yl]-pyrrolidin-1-ylmethanone
[(1R,2S)-1-oxo-1,3-dithiolan-2-yl]-pyrrolidin-1-ylmethanone (PubChem CID 134926279) has the molecular formula C8H13NO2S2
and a molecular weight of 219.33 g/mol. Its IUPAC name is [(1R,2S)-1-oxo-1,3-dithiolan-2-yl]-pyrrolidin-1-ylmethanone.
Molecular Properties
| Compound Name | [(1R,2S)-1-oxo-1,3-dithiolan-2-yl]-pyrrolidin-1-ylmethanone |
| PubChem CID | 134926279 |
| Molecular Formula | C8H13NO2S2 |
| Molecular Weight | 219.33 g/mol |
| Exact Mass | 219.04 |
| IUPAC Name | [(1R,2S)-1-oxo-1,3-dithiolan-2-yl]-pyrrolidin-1-ylmethanone |
| SMILES | O=C([C@H]1SCC[S@]1=O)N1CCCC1 |
| InChI | InChI=1S/C8H13NO2S2/c10-7(9-3-1-2-4-9)8-12-5-6-13(8)11/h8H,1-6H2/t8-,13+/m0/s1 |
| InChIKey | YEXQSZUDUGDSPN-ISVAXAHUSA-N |
| XLogP | 0.43 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.33 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [(1R,2S)-1-oxo-1,3-dithiolan-2-yl]-pyrrolidin-1-ylmethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1R,2S)-1-oxo-1,3-dithiolan-2-yl]-pyrrolidin-1-ylmethanone?
The IUPAC name of [(1R,2S)-1-oxo-1,3-dithiolan-2-yl]-pyrrolidin-1-ylmethanone (CID 134926279) is [(1R,2S)-1-oxo-1,3-dithiolan-2-yl]-pyrrolidin-1-ylmethanone.
What is the SMILES notation for [(1R,2S)-1-oxo-1,3-dithiolan-2-yl]-pyrrolidin-1-ylmethanone?
The canonical SMILES for [(1R,2S)-1-oxo-1,3-dithiolan-2-yl]-pyrrolidin-1-ylmethanone is O=C([C@H]1SCC[S@]1=O)N1CCCC1.
What is the InChIKey of [(1R,2S)-1-oxo-1,3-dithiolan-2-yl]-pyrrolidin-1-ylmethanone?
The InChIKey is YEXQSZUDUGDSPN-ISVAXAHUSA-N. The full InChI is InChI=1S/C8H13NO2S2/c10-7(9-3-1-2-4-9)8-12-5-6-13(8)11/h8H,1-6H2/t8-,13+/m0/s1.
What are the key properties of [(1R,2S)-1-oxo-1,3-dithiolan-2-yl]-pyrrolidin-1-ylmethanone?
[(1R,2S)-1-oxo-1,3-dithiolan-2-yl]-pyrrolidin-1-ylmethanone has a molecular weight of 219.33 g/mol, XLogP of 0.43, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(1R,2S)-1-oxo-1,3-dithiolan-2-yl]-pyrrolidin-1-ylmethanone is sourced from PubChem (CID 134926279), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).