About 2,5-dimethyl-1-prop-2-enyltellurolan-1-ium;tetraphenylboranuide
2,5-dimethyl-1-prop-2-enyltellurolan-1-ium;tetraphenylboranuide (PubChem CID 134926300) has the molecular formula C33H37BTe
and a molecular weight of 572.07 g/mol. Its IUPAC name is 2,5-dimethyl-1-prop-2-enyltellurolan-1-ium;tetraphenylboranuide.
Molecular Properties
| Compound Name | 2,5-dimethyl-1-prop-2-enyltellurolan-1-ium;tetraphenylboranuide |
| PubChem CID | 134926300 |
| Molecular Formula | C33H37BTe |
| Molecular Weight | 572.07 g/mol |
| Exact Mass | 574.21 |
| IUPAC Name | 2,5-dimethyl-1-prop-2-enyltellurolan-1-ium;tetraphenylboranuide |
| SMILES | C=CC[Te+]1C(C)CCC1C.c1ccc([B-](c2ccccc2)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C24H20B.C9H17Te/c1-5-13-21(14-6-1)25(22-15-7-2-8-16-22,23-17-9-3-10-18-23)24-19-11-4-12-20-24;1-4-7-10-8(2)5-6-9(10)3/h1-20H;4,8-9H,1,5-7H2,2-3H3/q-1;+1 |
| InChIKey | NOBXNXKQSZDOKV-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 572.07 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2,5-dimethyl-1-prop-2-enyltellurolan-1-ium;tetraphenylboranuide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5-dimethyl-1-prop-2-enyltellurolan-1-ium;tetraphenylboranuide?
The IUPAC name of 2,5-dimethyl-1-prop-2-enyltellurolan-1-ium;tetraphenylboranuide (CID 134926300) is 2,5-dimethyl-1-prop-2-enyltellurolan-1-ium;tetraphenylboranuide.
What is the SMILES notation for 2,5-dimethyl-1-prop-2-enyltellurolan-1-ium;tetraphenylboranuide?
The canonical SMILES for 2,5-dimethyl-1-prop-2-enyltellurolan-1-ium;tetraphenylboranuide is C=CC[Te+]1C(C)CCC1C.c1ccc([B-](c2ccccc2)(c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of 2,5-dimethyl-1-prop-2-enyltellurolan-1-ium;tetraphenylboranuide?
The InChIKey is NOBXNXKQSZDOKV-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H20B.C9H17Te/c1-5-13-21(14-6-1)25(22-15-7-2-8-16-22,23-17-9-3-10-18-23)24-19-11-4-12-20-24;1-4-7-10-8(2)5-6-9(10)3/h1-20H;4,8-9H,1,5-7H2,2-3H3/q-1;+1.
What are the key properties of 2,5-dimethyl-1-prop-2-enyltellurolan-1-ium;tetraphenylboranuide?
2,5-dimethyl-1-prop-2-enyltellurolan-1-ium;tetraphenylboranuide has a molecular weight of 572.07 g/mol, XLogP of 6.31, 6 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-dimethyl-1-prop-2-enyltellurolan-1-ium;tetraphenylboranuide is sourced from PubChem (CID 134926300), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).