C19H27N2O8P — CID 134926429
ethyl N-[(2R)-2-diethoxyphosphoryl-3-oxo-1H-inden-2-yl]-N-(ethoxycarbonylamino)carbamate (PubChem CID 134926429) has the molecular formula C19H27N2O8P and a molecular weight of 442.41 g/mol. Its IUPAC name is ethyl N-[(2R)-2-diethoxyphosphoryl-3-oxo-1H-inden-2-yl]-N-(ethoxycarbonylamino)carbamate.
| Compound Name | ethyl N-[(2R)-2-diethoxyphosphoryl-3-oxo-1H-inden-2-yl]-N-(ethoxycarbonylamino)carbamate |
|---|---|
| PubChem CID | 134926429 |
| Molecular Formula | C19H27N2O8P |
| Molecular Weight | 442.41 g/mol |
| Exact Mass | 442.15 |
| IUPAC Name | ethyl N-[(2R)-2-diethoxyphosphoryl-3-oxo-1H-inden-2-yl]-N-(ethoxycarbonylamino)carbamate |
| SMILES | CCOC(=O)NN(C(=O)OCC)[C@@]1(P(=O)(OCC)OCC)Cc2ccccc2C1=O |
| InChI | InChI=1S/C19H27N2O8P/c1-5-26-17(23)20-21(18(24)27-6-2)19(30(25,28-7-3)29-8-4)13-14-11-9-10-12-15(14)16(19)22/h9-12H,5-8,13H2,1-4H3,(H,20,23)/t19-/m1/s1 |
| InChIKey | JOKSDRLERVOOHK-LJQANCHMSA-N |
| XLogP | 3.51 |
| TPSA | 120.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.41 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|