About 1-[(1S,2R)-2-methyl-1-oxo-1,3-dithian-2-yl]ethanone
1-[(1S,2R)-2-methyl-1-oxo-1,3-dithian-2-yl]ethanone (PubChem CID 134926746) has the molecular formula C7H12O2S2
and a molecular weight of 192.30 g/mol. Its IUPAC name is 1-[(1S,2R)-2-methyl-1-oxo-1,3-dithian-2-yl]ethanone.
Molecular Properties
| Compound Name | 1-[(1S,2R)-2-methyl-1-oxo-1,3-dithian-2-yl]ethanone |
| PubChem CID | 134926746 |
| Molecular Formula | C7H12O2S2 |
| Molecular Weight | 192.30 g/mol |
| Exact Mass | 192.03 |
| IUPAC Name | 1-[(1S,2R)-2-methyl-1-oxo-1,3-dithian-2-yl]ethanone |
| SMILES | CC(=O)[C@]1(C)SCCC[S@@]1=O |
| InChI | InChI=1S/C7H12O2S2/c1-6(8)7(2)10-4-3-5-11(7)9/h3-5H2,1-2H3/t7-,11+/m1/s1 |
| InChIKey | YKFFXILIAMVKLN-HQJQHLMTSA-N |
| XLogP | 1.18 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.30 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[(1S,2R)-2-methyl-1-oxo-1,3-dithian-2-yl]ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(1S,2R)-2-methyl-1-oxo-1,3-dithian-2-yl]ethanone?
The IUPAC name of 1-[(1S,2R)-2-methyl-1-oxo-1,3-dithian-2-yl]ethanone (CID 134926746) is 1-[(1S,2R)-2-methyl-1-oxo-1,3-dithian-2-yl]ethanone.
What is the SMILES notation for 1-[(1S,2R)-2-methyl-1-oxo-1,3-dithian-2-yl]ethanone?
The canonical SMILES for 1-[(1S,2R)-2-methyl-1-oxo-1,3-dithian-2-yl]ethanone is CC(=O)[C@]1(C)SCCC[S@@]1=O.
What is the InChIKey of 1-[(1S,2R)-2-methyl-1-oxo-1,3-dithian-2-yl]ethanone?
The InChIKey is YKFFXILIAMVKLN-HQJQHLMTSA-N. The full InChI is InChI=1S/C7H12O2S2/c1-6(8)7(2)10-4-3-5-11(7)9/h3-5H2,1-2H3/t7-,11+/m1/s1.
What are the key properties of 1-[(1S,2R)-2-methyl-1-oxo-1,3-dithian-2-yl]ethanone?
1-[(1S,2R)-2-methyl-1-oxo-1,3-dithian-2-yl]ethanone has a molecular weight of 192.30 g/mol, XLogP of 1.18, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(1S,2R)-2-methyl-1-oxo-1,3-dithian-2-yl]ethanone is sourced from PubChem (CID 134926746), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).