C18H34Br2O2Se — CID 134926851
trans-(1S,2S)-1-[dibromo-[(1S,2S)-2-propan-2-yloxycyclohexyl]-λ4-selanyl]-2-propan-2-yloxycyclohexane (PubChem CID 134926851) has the molecular formula C18H34Br2O2Se and a molecular weight of 521.24 g/mol. Its IUPAC name is trans-(1S,2S)-1-[dibromo-[(1S,2S)-2-propan-2-yloxycyclohexyl]-λ4-selanyl]-2-propan-2-yloxycyclohexane.
| Compound Name | trans-(1S,2S)-1-[dibromo-[(1S,2S)-2-propan-2-yloxycyclohexyl]-λ4-selanyl]-2-propan-2-yloxycyclohexane |
|---|---|
| PubChem CID | 134926851 |
| Molecular Formula | C18H34Br2O2Se |
| Molecular Weight | 521.24 g/mol |
| Exact Mass | 520.01 |
| IUPAC Name | trans-(1S,2S)-1-[dibromo-[(1S,2S)-2-propan-2-yloxycyclohexyl]-λ4-selanyl]-2-propan-2-yloxycyclohexane |
| SMILES | CC(C)O[C@H]1CCCC[C@@H]1[Se](Br)(Br)[C@H]1CCCC[C@@H]1OC(C)C |
| InChI | InChI=1S/C18H34Br2O2Se/c1-13(2)21-15-9-5-7-11-17(15)23(19,20)18-12-8-6-10-16(18)22-14(3)4/h13-18H,5-12H2,1-4H3/t15-,16-,17-,18-/m0/s1 |
| InChIKey | GKIPKCRCCNVCDX-XSLAGTTESA-N |
| XLogP | 6.69 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.24 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|