About [3-[4-(trifluoromethyl)phenyl]-4-(trimethylsilylmethyl)-1,4-oxathian-4-yl] trifluoromethanesulfonate
[3-[4-(trifluoromethyl)phenyl]-4-(trimethylsilylmethyl)-1,4-oxathian-4-yl] trifluoromethanesulfonate (PubChem CID 134926973) has the molecular formula C16H22F6O4S2Si
and a molecular weight of 484.56 g/mol. Its IUPAC name is [3-[4-(trifluoromethyl)phenyl]-4-(trimethylsilylmethyl)-1,4-oxathian-4-yl] trifluoromethanesulfonate.
Molecular Properties
| Compound Name | [3-[4-(trifluoromethyl)phenyl]-4-(trimethylsilylmethyl)-1,4-oxathian-4-yl] trifluoromethanesulfonate |
| PubChem CID | 134926973 |
| Molecular Formula | C16H22F6O4S2Si |
| Molecular Weight | 484.56 g/mol |
| Exact Mass | 484.06 |
| IUPAC Name | [3-[4-(trifluoromethyl)phenyl]-4-(trimethylsilylmethyl)-1,4-oxathian-4-yl] trifluoromethanesulfonate |
| SMILES | C[Si](C)(C)CS1(OS(=O)(=O)C(F)(F)F)CCOCC1c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C16H22F6O4S2Si/c1-29(2,3)11-27(26-28(23,24)16(20,21)22)9-8-25-10-14(27)12-4-6-13(7-5-12)15(17,18)19/h4-7,14H,8-11H2,1-3H3 |
| InChIKey | GNPSKSRKORTLFT-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 484.56 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze [3-[4-(trifluoromethyl)phenyl]-4-(trimethylsilylmethyl)-1,4-oxathian-4-yl] trifluoromethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-[4-(trifluoromethyl)phenyl]-4-(trimethylsilylmethyl)-1,4-oxathian-4-yl] trifluoromethanesulfonate?
The IUPAC name of [3-[4-(trifluoromethyl)phenyl]-4-(trimethylsilylmethyl)-1,4-oxathian-4-yl] trifluoromethanesulfonate (CID 134926973) is [3-[4-(trifluoromethyl)phenyl]-4-(trimethylsilylmethyl)-1,4-oxathian-4-yl] trifluoromethanesulfonate.
What is the SMILES notation for [3-[4-(trifluoromethyl)phenyl]-4-(trimethylsilylmethyl)-1,4-oxathian-4-yl] trifluoromethanesulfonate?
The canonical SMILES for [3-[4-(trifluoromethyl)phenyl]-4-(trimethylsilylmethyl)-1,4-oxathian-4-yl] trifluoromethanesulfonate is C[Si](C)(C)CS1(OS(=O)(=O)C(F)(F)F)CCOCC1c1ccc(C(F)(F)F)cc1.
What is the InChIKey of [3-[4-(trifluoromethyl)phenyl]-4-(trimethylsilylmethyl)-1,4-oxathian-4-yl] trifluoromethanesulfonate?
The InChIKey is GNPSKSRKORTLFT-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H22F6O4S2Si/c1-29(2,3)11-27(26-28(23,24)16(20,21)22)9-8-25-10-14(27)12-4-6-13(7-5-12)15(17,18)19/h4-7,14H,8-11H2,1-3H3.
What are the key properties of [3-[4-(trifluoromethyl)phenyl]-4-(trimethylsilylmethyl)-1,4-oxathian-4-yl] trifluoromethanesulfonate?
[3-[4-(trifluoromethyl)phenyl]-4-(trimethylsilylmethyl)-1,4-oxathian-4-yl] trifluoromethanesulfonate has a molecular weight of 484.56 g/mol, XLogP of 5.24, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [3-[4-(trifluoromethyl)phenyl]-4-(trimethylsilylmethyl)-1,4-oxathian-4-yl] trifluoromethanesulfonate is sourced from PubChem (CID 134926973), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).