C13H23NO6 — CID 134927138
triethyl 2-(dimethylamino)ethane-1,1,2-tricarboxylate (PubChem CID 134927138) has the molecular formula C13H23NO6 and a molecular weight of 289.33 g/mol. Its IUPAC name is triethyl 2-(dimethylamino)ethane-1,1,2-tricarboxylate.
| Compound Name | triethyl 2-(dimethylamino)ethane-1,1,2-tricarboxylate |
|---|---|
| PubChem CID | 134927138 |
| Molecular Formula | C13H23NO6 |
| Molecular Weight | 289.33 g/mol |
| Exact Mass | 289.15 |
| IUPAC Name | triethyl 2-(dimethylamino)ethane-1,1,2-tricarboxylate |
| SMILES | CCOC(=O)C(C(=O)OCC)C(C(=O)OCC)N(C)C |
| InChI | InChI=1S/C13H23NO6/c1-6-18-11(15)9(12(16)19-7-2)10(14(4)5)13(17)20-8-3/h9-10H,6-8H2,1-5H3 |
| InChIKey | ZFXYNQRRABCBJQ-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.33 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|